On Target ESR1_HUMAN 0.53061223/CHEMBL194936
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.53061223, the most similar ligand is CHEMBL194936. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL194936 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | Oc1ccc(cc1)c2ccc3c(Br)c(O)ccc3c2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00006000 00008008 20000100 00010200 00000000 00000000 02000000 00000000 00000000 00000840 00000000 c0008000 00000012 00000001 00000000 00000008 00020000 02000000 04000000 00020000 00000000 08000008 10000000 00400000 00000000 80000000 00020000 00000040 00004000 00060000 00000008 08000000 |