On Target MIF_HUMAN 0.26136363/CHEMBL223266
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.26136363, the most similar ligand is CHEMBL223266. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL223266 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | COc1ccc(N\N=C\c2ccc(O)c(Br)c2)cc1 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 0000600a 00008008 20000108 00030200 00001000 04000000 02000000 01004008 40000100 00000841 00000004 c0008000 80000052 00000001 01010041 00084008 00000000 02000000 00000400 00220000 40080000 8c000000 70040802 00600000 00000000 80000800 40060000 00000000 00000208 000e1000 40000008 08000000 |