On Target NMDE1_HUMAN 0.13/CHEMBL284237
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.13, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |