On Target MK03_HUMAN 0.1981982/CHEMBL3798109
For the given ligand C2H3O2N2, we have found in our database that, being scored 0.1981982, the most similar ligand is CHEMBL3798109. Check out the elaboration below.
| C2H3O2N2 (Given Ligand) | CHEMBL3798109 (Similar Ligand) |
|---|---|
| Pc1ccc(Br)cc1c2ccccc2 | O=C(NCc1ccccc1)c2ccc3[nH]nc(c4ccncc4)c3c2 |
|
|
|
|
|
|
| 00006000 00008000 00020100 00010200 00000000 00000040 00000000 00000000 50000000 00000852 00000000 c0008000 00000010 00000000 00000000 00100000 00020008 02000000 04000000 00008000 10000000 08000000 90000000 00420000 00000000 80000000 20020000 10000040 00004000 00060000 00000008 08008000 | 00002002 00808808 a0004100 40010600 01040000 00000002 02400000 02001000 00000100 00000840 00200004 60008000 80008812 00400000 00000400 000c200c 00222000 02000004 04600000 10220200 c0000000 0c068608 30800800 0060400c 00100000 c0000000 10020000 80000060 00004104 00060001 80040400 00004220 |