On Target ALDR_HUMAN 0.30660376/CHEMBL274727
For the given ligand Celecoxib, we have found in our database that, being scored 0.30660376, the most similar ligand is CHEMBL274727. Check out the elaboration below.
| Celecoxib (Given Ligand) | CHEMBL274727 (Similar Ligand) |
|---|---|
| Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 | Fc1ccc(NS(=O)(=O)c2ccc(Cl)cc2C3NC(=O)NC3=O)cc1 |
|
|
|
|
|
|
| 00006036 00802208 a1100100 00b10600 01080010 00004002 00440400 00001400 00000104 000108f0 0900a004 6000800a 00000810 02000201 80200040 000c200c 00020000 02801000 04400000 10222008 c0100000 1801a020 30800800 8b404008 00000000 c0000040 30c20000 90000869 04004104 20460008 40260200 800126a2 | 00008013 0d803200 01100102 02b10e00 00080000 10600010 04000004 02003004 00001000 00080948 0d202004 6018b800 1f049c04 08001001 c0380040 00060000 00006088 02002000 00400020 00206001 c0020100 38218f00 301c0040 8b480018 00002080 80000000 10010000 8000000d 0c000500 20068003 20046000 80034660 |