On Target PAR1_HUMAN 0.39779004/CHEMBL80942
For the given ligand Hydromorphone, we have found in our database that, being scored 0.39779004, the most similar ligand is CHEMBL80942. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL80942 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | OC(=O)C[C@H](NC(=O)[C@@H]1CCCN(C1)C(=O)CCC2CCNCC2)c3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00010000 47801408 20100108 00010600 00001000 40000000 02040000 22001000 00200800 000809e0 48300000 50019000 0c00c81a 20000000 01000401 00288008 00000000 02000001 00c82018 00020201 80040300 181c8e30 010000c0 00548018 40001801 c0000000 00320000 b0000000 01000300 00060013 20040000 00012600 |