On Target HYES_HUMAN 0.6/CHEMBL1672128
For the given ligand Hydromorphone, we have found in our database that, being scored 0.6, the most similar ligand is CHEMBL1672128. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL1672128 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | COc1cccc2CCC(Cc12)C(=O)N[C@H]3C[C@@H]3c4ccccc4 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00010000 43001208 2010010a 00010600 00001000 40000002 07000000 20000205 00100880 000808c0 08300000 40019040 04008002 21200000 01000021 02042008 00000200 02000000 00082008 00020201 00000100 18240600 00004000 81500418 00000800 c0000001 00000000 10000000 04000302 0006c00b 00000000 00402600 |