On Target ACHA9_HUMAN 0.25751072/CHEMBL386114
For the given ligand Hydromorphone, we have found in our database that, being scored 0.25751072, the most similar ligand is CHEMBL386114. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL386114 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | C[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)[C@H](CS)NC(=O)CN)C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00070002 01007a00 00100100 45910e10 00141282 00000010 00012000 2000000c 00600880 020f08c2 08300014 4003b000 1e008812 00442809 80180040 000c000c 10000800 02000001 00e00418 00400301 40000100 38348e28 23800283 97500018 00043801 80000000 48010000 10000000 0c000002 0006002b 20044200 03812e20 |