On Target BACE1_HUMAN 0.5081081/CHEMBL3939118
For the given ligand Hydromorphone, we have found in our database that, being scored 0.5081081, the most similar ligand is CHEMBL3939118. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL3939118 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | COC1CCC2(CC1)Cc3ccc(OC4CCCC4)cc3C25NC(N)N(C)C5=O |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04010008 47000208 2050010a 10010f00 00081020 c2000002 02040004 02003001 00100800 000808c0 09300000 4081b000 0580b88a 21a03080 51000021 000e2008 00804218 02002000 02482000 00020201 00020100 38218610 01004000 81548110 00010000 80000101 00120000 90010000 0c000302 0186000b 000e6000 80400600 |