On Target DRD2_HUMAN 0.6690141/CHEMBL170976
For the given ligand Hydromorphone, we have found in our database that, being scored 0.6690141, the most similar ligand is CHEMBL170976. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL170976 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | CCCN1CCC[C@H]2[C@H]1CCc3cc4CCOc4cc23 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04001000 43000208 2010010a 00010600 00001061 c2000002 02040000 20000241 00100980 000808c0 08300000 50818800 00800002 20200080 01040021 020c2018 08000200 02000000 04082000 00020201 00000100 18200010 01004000 81500010 00000000 80000001 00120000 10800004 04000302 0006000a 00020000 00002600 |