On Target CNR2_HUMAN 0.5586207/CHEMBL426923
For the given ligand Hydromorphone, we have found in our database that, being scored 0.5586207, the most similar ligand is CHEMBL426923. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL426923 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | CCCCCCc1ccc(O)cc1OCCCCCCCCCCC(=O)NC2CC2 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04010001 01001008 2010010a 00010700 00081000 82000000 42000000 20000200 00000800 000808c0 08300000 40019040 0480800a 01a00000 11000001 00082008 00800000 22008000 00402000 00020a01 00000100 18000610 01000000 00500418 00000000 c0000000 00120000 10000000 00010302 00064003 00020000 00002600 |