On Target NTRK1_HUMAN 0.33193278/CHEMBL3676077
For the given ligand Hydromorphone, we have found in our database that, being scored 0.33193278, the most similar ligand is CHEMBL3676077. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL3676077 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | NC(=O)c1cnn2ccc(nc12)N3CCC[C@@H]3c4cc(F)ccc4OCC(O)CO |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04010002 45800008 6010018a 0a090610 20005000 82006114 0300e000 02301e00 00100910 211828c0 09300004 5001d040 04808827 08201002 01220d21 000c200c 00048000 2280c000 01400000 00e20a01 80100140 1c048600 25815840 8a500418 00142400 c0000081 88048000 90800981 00101308 0046c802 e4041000 800046e0 |