On Target MTOR_HUMAN 0.37444934/CHEMBL4074753
For the given ligand Hydromorphone, we have found in our database that, being scored 0.37444934, the most similar ligand is CHEMBL4074753. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL4074753 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | Brc1ccc(cc1)C(N(C2CC2)C(=O)CCc3ccc(OCCCCNCCOCCOCCNC(=O)CCCC[C@@H]4SC[C@@H]5NC(=O)N[C@H]45)cc3)C(=O)NCc6ccccc6 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04014000 4780f208 20100108 84110f40 00101080 02000000 02040004 22003048 04202880 020948c0 08300000 4007b000 0781981e 01042100 d1081409 000d2008 14001000 02002c00 00402068 00020301 c0000100 38258610 17000301 8b700018 00010c00 c0000000 00924200 90000021 0c000300 0006002b 200e6008 0b012e00 |