On Target IKKB_HUMAN 0.38219896/CHEMBL184041
For the given ligand Hydromorphone, we have found in our database that, being scored 0.38219896, the most similar ligand is CHEMBL184041. Check out the elaboration below.
| Hydromorphone (Given Ligand) | CHEMBL184041 (Similar Ligand) |
|---|---|
| CN4CC[C@]23c1c5ccc(O)c1O[C@H]2C(=O)CC[C@H]3[C@H]4C5 | Cc1cc(cc(C)c1O[C@H](Cc2ccccc2)C(=O)O)c3c4ccccc4c(Br)c5sc(C)c(C)c35 |
|
|
|
|
|
|
| 04011000 43000208 2010050a 00210700 00181061 c2000002 07000000 20000241 00050880 000818c0 08340000 5081d040 0480c01a 20a00080 11040021 020ca018 08800200 a2008000 06482008 00020201 00000100 18200210 01004000 81500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 05017000 11008008 20040908 00010200 04181041 02000000 02040080 00000040 00010990 00080840 08140200 c001d080 0480801a 00a00001 01243181 0008200c 08020000 a2009008 04400088 10020001 00000100 48040a88 158000c0 08400010 02000803 84000000 00130008 00800045 00804300 10060002 00000008 08c10400 |