On Target PERM_HUMAN 0.43312103/CHEMBL490
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.43312103, the most similar ligand is CHEMBL490. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL490 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | Fc1ccc(cc1)[C@@H]2CCNC[C@H]2COc3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04000001 01000208 20100108 02010700 00081000 02000010 42000000 20000000 00200800 000808c0 48300000 50018000 00804002 01001000 11000001 002ca008 00a00000 02000084 00c80000 00120a01 00040300 18000000 010000c0 00500010 40000001 80000000 00080000 30000001 01050200 0006800a 00000000 02012640 |