On Target FABP5_HUMAN 0.33333334/CHEMBL212860
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | OC(=O)Cc1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |