On Target NK1R_HUMAN 0.5030303/CHEMBL2112368
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.5030303, the most similar ligand is CHEMBL2112368. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL2112368 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | COc1ccc(OC(F)(F)F)cc1[C@H]2COC3(CCCN[C@H]3c4ccccc4)C2 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 00000040 43000008 2011010a 80010700 001910d1 40000000 02000000 22009240 00100800 000808c0 08300000 50418140 00000802 21a00000 010c1409 00083008 18000000 02000000 04482000 00020201 00010120 18008010 13000048 00500410 10000400 c0000000 00080200 d0000001 02000302 00074002 20060000 02002e00 |