On Target GRM5_HUMAN 0.4097222/CHEMBL1289626
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.4097222, the most similar ligand is CHEMBL1289626. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL1289626 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | OC1CN(CCCCc2ccccc2)CCc3cc(O)ccc13 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 00000000 43000008 20100102 00010600 000000a0 80004000 02000000 20000001 00100980 000808c0 08300000 40818800 00000002 00200000 00080000 00080008 10000200 02100000 00000000 00020201 00000900 18200020 02004000 81500010 00000000 80000200 00520000 10000000 04000000 00060002 40000000 00002600 |