On Target SCN9A_HUMAN 0.4408602/CHEMBL3658010
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.4408602, the most similar ligand is CHEMBL3658010. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL3658010 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | Fc1cc(OCC23CC4CC(CC(C4)C2)C3)c(cc1C(=O)NS(=O)(=O)N5CCC6(CC5)COC6)C7CC7 |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04000020 05000808 22180109 13210700 00181001 82000010 12040000 20001200 00000800 0008dac0 08702000 50018040 00818842 01801001 31400001 08082008 16800200 22008080 06402400 00124209 00001100 1802c600 01000000 10c00414 00000002 c0000000 48220200 10000011 00000300 40068002 c0060010 00010f60 |