On Target CXCR1_HUMAN 0.28947368/CHEMBL490688
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.28947368, the most similar ligand is CHEMBL490688. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL490688 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c3ccc4OCCOc4c3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 14010002 46010888 20100109 01210e20 20001000 48020010 02040210 0a101600 00803900 00080851 88352004 4000c880 0a80c812 20100081 01240041 100ce00c 00040000 1a005000 08080012 10024201 41100100 18228f00 25010010 08458015 00840002 80800480 20320000 80800090 20408308 1006000b c6041000 00010600 |