On Target MK03_HUMAN 0.31428573/CHEMBL555017
For the given ligand Dihydrocodeine, we have found in our database that, being scored 0.31428573, the most similar ligand is CHEMBL555017. Check out the elaboration below.
| Dihydrocodeine (Given Ligand) | CHEMBL555017 (Similar Ligand) |
|---|---|
| COc1ccc2C[C@@H]5[C@@H]3CCC(O)[C@@H]4Oc1c2[C@]34CCN5C | CC(=CCC[C@@]1(C)Oc2c(CC=C(C)C)c3O[C@@]45[C@H]6C[C@@H](C=C4C(=O)c3c(O)c2C=C1)C(=O)[C@]5(C\C=C(\C)/C(=O)O)OC6(C)C)C |
|
|
|
|
|
|
| 04001000 43000208 2010050a 00210700 00181061 c2000002 02041000 20000241 00000890 000818c0 08300000 50818040 00804002 21a00080 11240021 020ca018 08800200 22008000 06482000 00020201 00000100 18200010 05004040 89500410 00000000 c0000001 00120200 10800000 04000302 0007c80a 00020000 00002f40 | 04050041 81000838 22800b0b 80210302 00281041 82a20800 c22402c1 28000642 05042854 019a0a48 48140200 4000d060 1682802a 00a00000 11280407 0808b008 00800400 a2108124 1361201e 0202a801 00040120 18021a80 0500a061 0a400014 01201400 c0000400 00526a08 c0800420 00414302 80234002 a4020000 00000410 |