On Target AGTR2_HUMAN 0.4924623/CHEMBL40381
For the given ligand Indomethacin, we have found in our database that, being scored 0.4924623, the most similar ligand is CHEMBL40381. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL40381 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CCCc1nc2c(C)ccnc2n1Cc3ccc(OC(C(=O)O)c4ccccc4Cl)cc3 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0400800a 00800a08 20185508 10050610 040c1060 0000c000 02048000 00001000 90700100 100818d0 0804800c 4081da00 83809886 00918000 412f00c1 020c000c 08001000 86800000 00680008 40030001 c0001400 18008b30 25800041 89d01514 00042000 c0002202 00228008 00800000 04000204 00c6080a c00c2004 200204a0 |