On Target IKKB_HUMAN 0.3898305/CHEMBL1761510
For the given ligand Indomethacin, we have found in our database that, being scored 0.3898305, the most similar ligand is CHEMBL1761510. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL1761510 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | NC(=O)c1cc(cc2c(c[nH]c12)C3CCCNC3)c4ccccc4 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 00002002 01800800 00100102 41810610 00041101 04000000 10006000 00001000 00500980 000908c0 09300004 50018800 98008802 00600800 00000040 0804000c 00020000 02001004 04200400 10000203 c0000100 18228608 30800000 9150001c 00042000 80000000 08000040 10000041 14404000 00060002 80040200 80002620 |