On Target PPARG_HUMAN 0.8/CHEMBL360762
For the given ligand Indomethacin, we have found in our database that, being scored 0.8, the most similar ligand is CHEMBL360762. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL360762 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | COc1ccc2c(c1)c(Cc3ccc(OC(C)(C)C(=O)O)cc3)c(C)n2C(=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0c008002 00000a08 20100188 50010718 00045020 00000000 060c2400 01001000 80500000 000808c0 08040004 4001f800 02808866 00608000 01220041 020c000c 00810000 83800004 01280400 00020200 40000000 18028f18 25804000 89500014 00042000 e0000000 08160008 50800000 06000284 0006004b a0044200 00020420 |