On Target ACM4_HUMAN 0.4375/CHEMBL104332
For the given ligand Indomethacin, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL104332. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL104332 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | COc1ccc(Cn2c(C)c(C(=O)OCC=C)c3c4CN5CCc6cc(OC)ccc6C5Oc4ccc23)cc1 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0400000a 42809a08 60100109 90010610 00041030 8000c500 161c0000 22021404 94500380 00180cc0 48200004 40018800 808088a6 2061a000 01020441 0a1e200c 00022209 82888024 00290012 40020200 c0020840 18268a78 20804000 81d0301c 00046400 c0012222 086a4040 90000020 04400305 0006004a e40c8204 00800630 |