On Target DRD2_HUMAN 0.5398773/CHEMBL245764
For the given ligand Indomethacin, we have found in our database that, being scored 0.5398773, the most similar ligand is CHEMBL245764. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL245764 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | COc1ccc2c(c1)c3CCN(C)CCc4ccccc4Cc3n2C |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0000000a 20004808 20100108 51010610 00045020 00080000 060c2400 01001001 04400080 000908c0 08208004 40818000 10000806 00608000 01020441 0204008c 00000200 82800005 00300400 00020200 40000000 18208018 20804001 91400414 00042000 e0000000 08120000 40000000 06000284 00060042 00040200 20012620 |