On Target CNR1_HUMAN 0.5675676/CHEMBL2206858
For the given ligand Indomethacin, we have found in our database that, being scored 0.5675676, the most similar ligand is CHEMBL2206858. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL2206858 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CCCn1c(C)c(C(=O)c2ccc(Cl)c3ccccc23)c4ccccc14 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 08008002 00801800 00100100 50010618 00045020 00008000 00002400 01000004 00400000 000808c0 08000004 40018800 02008824 00608000 00020040 02040004 00010000 82800004 00200400 00000000 c0000000 18068718 20804000 8050001c 00042000 e0000000 08040000 50000000 02000084 00060042 a0044200 00020420 |