On Target NMDE2_HUMAN 0.43225807/CHEMBL444384
For the given ligand Indomethacin, we have found in our database that, being scored 0.43225807, the most similar ligand is CHEMBL444384. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL444384 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | O=C(CN1CCC(Cc2ccccc2)CC1)c3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 00000002 01801800 00100102 41010610 00041000 00000000 00002000 20000004 00500880 000908c0 08300004 5001a000 12008802 00600000 80000040 00040004 00000000 02000000 00200400 00000201 c0000100 18228208 20800000 9150001c 00042000 80000000 08000000 10000000 04000000 00060002 80044200 00002620 |