On Target DRD4_HUMAN 0.43636364/CHEMBL460854
For the given ligand Indomethacin, we have found in our database that, being scored 0.43636364, the most similar ligand is CHEMBL460854. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL460854 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | OC1(CC2CCC(C1)N2CCc3c[nH]c4ccccc34)c5ccc(Cl)cc5 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 00008002 01000a00 00100102 41010610 000c1000 00004010 00002000 20000000 00400980 000908c0 08300004 50018800 120008a6 00e00000 00000040 000c000c 00000000 02000000 00e02400 00000201 40000100 18208138 21800080 91500010 00042001 80000000 08040000 10001000 04000002 0006000a 40060200 00022620 |