On Target PAR1_HUMAN 0.40588236/CHEMBL231942
For the given ligand Etoricoxib, we have found in our database that, being scored 0.40588236, the most similar ligand is CHEMBL231942. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL231942 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | C[C@H]1OC(=O)[C@@H]2C[C@@H]3CCCC[C@H]3[C@H](\C=C\c4ccc(cn4)c5ccccn5)[C@H]12 |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 00052042 81010000 00004300 90010710 000c1020 04000008 80000080 08080408 00000100 10108058 00008004 40009010 04028808 00800000 010a0402 820c100c 00820400 0a003004 06602000 10402007 41000020 08108a00 31808020 00410010 01040403 82080000 08406240 c0008240 00404204 00060402 24020820 00000000 |