On Target TRPV3_HUMAN 0.47272727/CHEMBL3692319
For the given ligand Etoricoxib, we have found in our database that, being scored 0.47272727, the most similar ligand is CHEMBL3692319. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL3692319 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | CC(C)[C@H](CO)NCc1nc(ccc1Cl)c2ccc(nc2)C(F)(F)F |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 0002a01a 00010000 00104100 10000e10 000410a1 0410000a 01400400 02083041 00000100 10000070 04218004 40000810 0600080a 01000000 00120400 820c010c 10020000 02003026 04600008 10400207 40000800 18018100 33800000 00400010 00140803 c0080200 08040340 90001150 00404104 00260400 28140820 11024200 |