On Target P2RX3_HUMAN 0.30414745/CHEMBL3643305
For the given ligand Etoricoxib, we have found in our database that, being scored 0.30414745, the most similar ligand is CHEMBL3643305. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL3643305 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | CC(Nc1ncnc2CCN(Cc12)c3ccc(C)cn3)c4ccc(cc4)S(=O)(=O)C |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 1401400a 00801a00 40124186 589d0610 24061020 00104040 0000c000 02101800 00400100 20080a50 4820a004 6000d800 14000882 00319000 81220c00 001c0004 04060a00 0b004026 08602000 40a02200 c4120800 1c2c8800 23814840 09640119 00043000 80000280 08000080 800010a0 0440810c 00460802 60041020 e00106e0 |