On Target DRD3_HUMAN 0.36842105/CHEMBL244773
For the given ligand Etoricoxib, we have found in our database that, being scored 0.36842105, the most similar ligand is CHEMBL244773. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL244773 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | Cc1cccnc1c2ccc(cc2)C(=O)NC\C=C\CN3CCN(CC3)c4cccc(Cl)c4Cl |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 0000e022 00008801 02004120 55010610 00041020 00000000 08100000 0a081400 00000100 10000a40 00208004 40008800 82008806 00212001 20020440 02040004 20060000 12002104 0c200000 10405000 40100000 28028700 30800020 0241000e 00042000 c0100400 08480240 800001c0 0840c104 00060401 8c040800 00020200 |