On Target PRGR_HUMAN 0.375/CHEMBL3605932
For the given ligand Etoricoxib, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL3605932. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL3605932 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | CS(=O)(=O)Nc1cccc2c(c[nH]c12)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 0000a002 00000804 00000106 01b10630 00041000 04000008 04000000 00401000 00000000 00000840 00002004 60008800 02000c04 00400001 80080040 80060004 00020000 02000400 04200000 00006000 40000000 08028908 30800000 80400008 00042081 80080000 08000280 0000004c 00004000 00460000 00040200 000300e0 |