On Target FABP5_HUMAN 0.33333334/CHEMBL212860
For the given ligand Oxycodone, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL212860. Check out the elaboration below.
| Oxycodone (Given Ligand) | CHEMBL212860 (Similar Ligand) |
|---|---|
| COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O | OC(=O)Cc1cccc(OCc2ccccc2Cl)c1OCc3ccccc3Cl |
|
|
|
|
|
|
| 04051000 43000208 2010050a 00210700 001810e1 c2000002 07041000 20008241 00050880 010818c0 08340000 5081d140 0480c01a 22a00080 110c0021 020ca018 18800200 a2008000 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04008000 42000008 20000108 00210200 00001041 80004000 02000000 08008200 00000100 00080840 08000000 40009900 0380c006 20010080 41040001 0208a008 08001000 02008000 00480000 00020200 00001000 08000b20 01000000 00c01010 00006000 c0002602 00000000 00010000 00000300 0002000a 40002000 00020400 |