On Target DRD2_HUMAN 0.61935484/CHEMBL170976
For the given ligand Oxycodone, we have found in our database that, being scored 0.61935484, the most similar ligand is CHEMBL170976. Check out the elaboration below.
| Oxycodone (Given Ligand) | CHEMBL170976 (Similar Ligand) |
|---|---|
| COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O | CCCN1CCC[C@H]2[C@H]1CCc3cc4CCOc4cc23 |
|
|
|
|
|
|
| 04051000 43000208 2010050a 00210700 001810e1 c2000002 07041000 20008241 00050880 010818c0 08340000 5081d140 0480c01a 22a00080 110c0021 020ca018 18800200 a2008000 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04001000 43000208 2010010a 00010600 00001061 c2000002 02040000 20000241 00100980 000808c0 08300000 50818800 00800002 20200080 01040021 020c2018 08000200 02000000 04082000 00020201 00000100 18200010 01004000 81500010 00000000 80000001 00120000 10800004 04000302 0006000a 00020000 00002600 |