On Target HPGDS_HUMAN 0.24686192/CHEMBL3698267
For the given ligand Oxycodone, we have found in our database that, being scored 0.24686192, the most similar ligand is CHEMBL3698267. Check out the elaboration below.
| Oxycodone (Given Ligand) | CHEMBL3698267 (Similar Ligand) |
|---|---|
| COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O | CCC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(CCn5ccnn5)cc4 |
|
|
|
|
|
|
| 04051000 43000208 2010050a 00210700 001810e1 c2000002 07041000 20008241 00050880 010818c0 08340000 5081d140 0480c01a 22a00080 110c0021 020ca018 18800200 a2008000 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00014002 0104be18 60100100 44010e00 60080000 00002001 04100004 20002408 11100000 101a09e0 08240004 50019800 0402b006 2081a000 00020240 000c000c 20044010 02000100 084900c0 02041201 60120100 38090600 61009061 8350081a 00212000 80000000 00480000 90000080 0c008000 800e001b 04100000 04008600 |