On Target PTGES_HUMAN 0.3960396/CHEMBL538661
For the given ligand Oxycodone, we have found in our database that, being scored 0.3960396, the most similar ligand is CHEMBL538661. Check out the elaboration below.
| Oxycodone (Given Ligand) | CHEMBL538661 (Similar Ligand) |
|---|---|
| COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O | COC(=O)\C=C\c1cc(O)c2O[C@H]([C@H](C(=O)OC)c2c1)c3ccc(O)c(O)c3 |
|
|
|
|
|
|
| 04051000 43000208 2010050a 00210700 001810e1 c2000002 07041000 20008241 00050880 010818c0 08340000 5081d140 0480c01a 22a00080 110c0021 020ca018 18800200 a2008000 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 04001000 4a000008 20010108 00210300 00001041 c2204000 82040080 08008640 01800900 01080848 48100000 40109140 1580c002 00010000 41040003 0208a018 48020400 02008000 05418018 00020201 00000100 18100a20 01000061 02c01010 00005800 c0002400 00522008 40014404 00404300 00220102 44002000 00000550 |