On Target NMDE1_HUMAN 0.24022347/CHEMBL284237
For the given ligand Oxycodone, we have found in our database that, being scored 0.24022347, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Oxycodone (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| COc2ccc1C[C@H]4N(C)CC[C@]35c1c2O[C@H]3C(=O)CC[C@@]45O | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 04051000 43000208 2010050a 00210700 001810e1 c2000002 07041000 20008241 00050880 010818c0 08340000 5081d140 0480c01a 22a00080 110c0021 020ca018 18800200 a2008000 07482008 00020201 00000100 18200210 03004040 83500410 00000800 c0000001 00120208 10000000 04000302 0006c80a 00020000 00002e40 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |