On Target HRH1_HUMAN 0.47058824/CHEMBL2158825
For the given ligand Diclofenac, we have found in our database that, being scored 0.47058824, the most similar ligand is CHEMBL2158825. Check out the elaboration below.
| Diclofenac (Given Ligand) | CHEMBL2158825 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | OC(=O)Cc1ccccc1N2CCC(CN3CCC(CC3)Oc4ccc(Cl)c(Cl)c4)CC2 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 0400c002 01000008 20100108 00010600 20001040 02002040 92000000 20000000 00200000 000808c0 08200004 50039800 03808006 00000002 41060043 0008200a 08248000 02000400 08800000 00020201 40100400 58000b00 21000080 00500010 00002001 80100200 00100000 10001080 00088200 00061002 00002000 20022640 |