On Target COMT_HUMAN 0.31976745/CHEMBL3425732
For the given ligand Test, we have found in our database that, being scored 0.31976745, the most similar ligand is CHEMBL3425732. Check out the elaboration below.
| Test (Given Ligand) | CHEMBL3425732 (Similar Ligand) |
|---|---|
| Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 | OCC1=CC(=O)C(=CN1c2ccc(cc2)c3ccccc3)O |
|
|
|
|
|
|
| 00006036 00802208 a1100100 00b10600 01080010 00004002 00440400 00001400 00000104 000108f0 0900a004 6000800a 00000810 02000201 80200040 000c200c 00020000 02801000 04400000 10222008 c0100000 1801a020 30800800 8b404008 00000000 c0000040 30c20000 90000869 04004104 20460008 40260200 800126a2 | 00002002 00000a08 60004100 10010600 00040028 00004004 04800000 00201000 02100300 800008c0 00000004 40018000 80008804 00400200 00020040 020c000c 00028000 02804004 04200000 00060000 40000000 18028030 30800002 81500004 02002400 c0000040 00420060 00040040 04004004 08060008 c0040000 40200000 |