On Target ESR1_HUMAN 0.58928573/CHEMBL481189
For the given ligand Test, we have found in our database that, being scored 0.58928573, the most similar ligand is CHEMBL481189. Check out the elaboration below.
| Test (Given Ligand) | CHEMBL481189 (Similar Ligand) |
|---|---|
| Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 | Cc1c(nn(c2ccc(O)cc2)c1c3ccc(CCCN4CCCCC4)cc3)c5ccc(O)cc5 |
|
|
|
|
|
|
| 00006036 00802208 a1100100 00b10600 01080010 00004002 00440400 00001400 00000104 000108f0 0900a004 6000800a 00000810 02000201 80200040 000c200c 00020000 02801000 04400000 10222008 c0100000 1801a020 30800800 8b404008 00000000 c0000040 30c20000 90000869 04004104 20460008 40260200 800126a2 | 00006006 41000209 a0100180 00010610 01080000 00006002 02440000 20001000 00000904 000908c0 09308004 70018808 00800832 00200200 20000840 000c204c 00020000 82801000 04480100 10220201 40100100 1801a024 30800800 83504018 00000000 c0000040 14060000 10000861 04004184 1046000a 40060200 830026a2 |