On Target PDE5A_HUMAN 0.09392265/CHEMBL484065
For the given ligand test, we have found in our database that, being scored 0.09392265, the most similar ligand is CHEMBL484065. Check out the elaboration below.
| test (Given Ligand) | CHEMBL484065 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CCN1C(=O)C2C(N=CN2Cc3ccc(O)c(Br)c3)N4[C@H]5CCC[C@H]5N=C14 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 0000c040 23008408 20100140 84010e00 22000020 00080000 22c30044 22003000 40000640 00030df2 12202030 c001b000 0b00bc12 00012009 00001500 00310088 10010818 02000000 00100050 00020201 00312100 3a038620 00008013 02500218 10013090 c0000000 40630000 90001000 0a000110 01060011 801c4109 08012200 |