On Target AMPN_HUMAN 0.103896104/CHEMBL1782887
For the given ligand test, we have found in our database that, being scored 0.103896104, the most similar ligand is CHEMBL1782887. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1782887 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | N[C@H]1CC\C=C\CC[C@H](NC(=O)C[C@H](Cc2ccc(O)cc2)NC1=O)C(=O)NCc3ccccc3CC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00010008 01803408 20900902 14010600 00000040 00000000 02000000 2200140e 10100880 001989e0 08300000 4001b000 0f028882 00202000 c0040480 00080008 08004000 02000001 00010010 00020201 80020100 382c8e00 0100c001 83500018 00201000 c0000100 00524000 90000000 0c000100 00060813 24046000 00402600 |