On Target PPARG_HUMAN 0.21052632/CHEMBL2382279
For the given ligand test, we have found in our database that, being scored 0.21052632, the most similar ligand is CHEMBL2382279. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2382279 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CCCCC\C=C\C=C\1/[C@@H](CCCCC(=O)O)C=CC1=O |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00010002 01040000 00000000 00080000 40080000 00000001 00000080 00000402 01000000 00100000 00000000 40001000 04028008 20800000 00000400 0008000c 00000000 00000000 00492080 00020001 00002001 00000a80 01008000 00000812 00200000 00200000 00404000 80000000 00000000 80000000 24020000 00000000 |