On Target PPAP_HUMAN 0.05940594/CHEMBL501717
For the given ligand test, we have found in our database that, being scored 0.05940594, the most similar ligand is CHEMBL501717. Check out the elaboration below.
| test (Given Ligand) | CHEMBL501717 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | Cl.C[C@@H](N[C@H](c1ccccc1)P(=O)(O)O)c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00010010 00000600 00000100 00010600 00000000 00400000 04000000 02001000 000000c0 00080840 08200000 40008000 00000802 00020000 8008040c 00000000 00003028 02000000 00000000 00000200 00000000 0d308000 00000000 00400010 00000000 c6010006 00000000 80014000 00000100 30060002 00040000 00028603 |