On Target TNFA_HUMAN 0.1005291/CHEMBL3642449
For the given ligand test, we have found in our database that, being scored 0.1005291, the most similar ligand is CHEMBL3642449. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3642449 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | COc1ccc2CN(C[C@]3(NC(=O)NC3=O)C#Cc4ccc(cc4)C5=NCCN5)C(=O)c2c1 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00000200 45863c08 28300908 9c090e00 60403000 00048010 12040084 02103028 00000900 00038963 50200010 5000b808 8c00b802 1020b008 01144401 20180008 00002810 02402001 00080010 80020211 80220100 389b8680 00080001 0244881d 10001084 c0200000 40224080 80000000 08000318 08068011 e0144880 00000200 |