On Target NMDE2_HUMAN 0.21052632/CHEMBL158737
For the given ligand test, we have found in our database that, being scored 0.21052632, the most similar ligand is CHEMBL158737. Check out the elaboration below.
| test (Given Ligand) | CHEMBL158737 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | COc1ccccc1C\N=C(/N)\C=C\c2ccccc2 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00000000 00000008 20200108 00010620 00001000 00000100 92200080 10001400 00000000 00000843 00000010 40008000 00000802 00000008 01000003 00103c88 20000c00 03000100 00000000 00820040 00000001 28008000 00000000 00400800 00000008 80100000 40402040 50410800 00400300 00060000 04040000 00100000 |