On Target MDR1_HUMAN 0.2361111/CHEMBL635
For the given ligand test, we have found in our database that, being scored 0.2361111, the most similar ligand is CHEMBL635. Check out the elaboration below.
| test (Given Ligand) | CHEMBL635 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | C[C@]12CC(=O)[C@H]3[C@@H](CCC4=CC(=O)C=C[C@]34C)[C@@H]1CC[C@]2(O)C(=O)CO |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00050002 01000000 00000000 00080000 00080000 00000000 00000080 02000402 01000000 00120000 00000000 40005000 04028008 00800000 00000400 00080008 00000000 00000000 03412000 02020001 00000001 00000280 01008000 00000810 00200000 00000000 00404000 80000000 00000000 81000000 24020000 00000000 |