On Target AGTR2_HUMAN 0.13690476/CHEMBL39352
For the given ligand test, we have found in our database that, being scored 0.13690476, the most similar ligand is CHEMBL39352. Check out the elaboration below.
| test (Given Ligand) | CHEMBL39352 (Similar Ligand) |
|---|---|
| CC(=O)N=c1ccc(=O)cc1 | CCCC1=NC(C)(C)C(=O)N1Cc2ccc(cc2)c3ccccc3S(=O)(=O)NC(=O)c4ccccc4 |
|
|
|
|
|
|
| 00000000 00000000 00200000 00080400 00000000 00000000 10000000 12000402 01000020 00100003 00000000 40000001 00008000 00000000 00000000 00000080 00000800 00000000 00110000 00008040 00000001 20001680 00008000 00000810 00000000 00000000 40401000 00400800 00000010 00040000 06000000 00020000 | 00002052 00801801 01380140 01b90e00 00080000 00000008 14000001 22001000 00000308 20013cd3 10312010 6000b000 80188c02 00000009 80300400 00100000 02022880 02100000 04418000 10006201 80210001 38068680 10008011 0a40081c 02002084 c0000084 c0400000 9400004c 0a004510 20068041 a0045000 00012360 |